cas: 16832-24-9 — see every product listed under this CAS number, including other names
1-(Phenylmethyl)-L-histidine, 97%, 97% (CAS 16832-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Y1N-250mg |
| cas | 16832-24-9 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 635.60 Pln | |
| Chemat | 25g | 2066.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid (CAS 16832-24-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid. InChIKey: NMXSWQMJOZUQKY-LBPRGKRZSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid |
| InChIKey | NMXSWQMJOZUQKY-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)