cas: 16832-24-9 — see every product listed under this CAS number, including other names
H-His(Bzl)-OH 97% (CAS 16832-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A367706-250mg |
| cas | 16832-24-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 887.69 Pln | |
| Ambeed | 25g | 2934.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A367706 |
(2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid (CAS 16832-24-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid. InChIKey: NMXSWQMJOZUQKY-LBPRGKRZSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoic acid |
| InChIKey | NMXSWQMJOZUQKY-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)