cas: 342404-46-0 — see every product listed under this CAS number, including other names
1-(Phenylsulfonyl)-1H-indol-2-ylboronic acid, 97%, May contain varying amounts of anhydride (CAS 342404-46-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC03312DA |
| cas | 342404-46-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 403.19 Pln | |
| Thermo Scientific | 5g | 1639.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
[1-(benzenesulfonyl)indol-2-yl]boronic acid (CAS 342404-46-0) is a chemical compound with the molecular formula C14H12BNO4S and a molecular weight of 301.1 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-2-yl]boronic acid. InChIKey: HXWLCYMHOULBJZ-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO4S |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | [1-(benzenesulfonyl)indol-2-yl]boronic acid |
| InChIKey | HXWLCYMHOULBJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N1S(=O)(=O)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)