CAS 129271-98-3 appears in our catalog under these names: (1-(Phenylsulfonyl)-1H-indol-3-yl)boronic acid, 98%, 98%, 1-Phenylsulfonylindole-3-boronic acid, 98%, 1-(PHENYLSULFONYL)-3-INDOLYLBORONIC ACI&, 1-(Phenylsulfonyl)-1H-indol-3-ylboronic acid, 97%, May contain varying amounts of anhydride , (1-(Phenylsulfonyl)-1H-indol-3-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Sigma-Aldrich, Thermo Scientific, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[1-(benzenesulfonyl)indol-3-yl]boronic acid (CAS 129271-98-3) is a chemical compound with the molecular formula C14H12BNO4S and a molecular weight of 301.1 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-3-yl]boronic acid. InChIKey: YKTZLHLBQGCFQX-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO4S |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | [1-(benzenesulfonyl)indol-3-yl]boronic acid |
| InChIKey | YKTZLHLBQGCFQX-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=CC=CC=C12)S(=O)(=O)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)