cas: 5033-22-7 — see every product listed under this CAS number, including other names
1-(Phenylsulfonyl)pyrrolidine, ≥98%, ≥98% (CAS 5033-22-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DACN-1g |
| cas | 5033-22-7 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1480.40 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)pyrrolidine (CAS 5033-22-7) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 1-(benzenesulfonyl)pyrrolidine. InChIKey: DSWRVRWIXRRDLN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 1-(benzenesulfonyl)pyrrolidine |
| InChIKey | DSWRVRWIXRRDLN-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)