CAS 23032-53-3 appears in our catalog under these names: H-D-Cys(bzl)-oh, 95%, H–D–Cys(Bzl)–OH, H-D-Cys(Bzl)-OH. Offered by: Combi-blocks, GLPBio, Iris Biotech, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, Get quote.
(2S)-2-amino-3-benzylsulfanylpropanoic acid (CAS 23032-53-3) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: (2S)-2-amino-3-benzylsulfanylpropanoic acid. InChIKey: GHBAYRBVXCRIHT-SECBINFHSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | (2S)-2-amino-3-benzylsulfanylpropanoic acid |
| InChIKey | GHBAYRBVXCRIHT-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)