CAS 17688-68-5 appears in our catalog under these names: 4-Phenylthiomorpholine 1,1-dioxide, 98%, 4–Phenylthiomorpholine 1,1–Dioxide, 4-Phenylthiomorpholine 1,1-Dioxide, >98.0%(GC), 4-Phenylthiomorpholine 1,1-Dioxide, 98%, 98%, 4-Phenylthiomorpholine 1,1-dioxide, 96%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
4-phenyl-1,4-thiazinane 1,1-dioxide (CAS 17688-68-5) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 4-phenyl-1,4-thiazinane 1,1-dioxide. InChIKey: OLQHDKQJHKZUNN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 4-phenyl-1,4-thiazinane 1,1-dioxide |
| InChIKey | OLQHDKQJHKZUNN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC=C2 |
Computed by PubChem (NCBI)