cas: 885954-14-3 — see every product listed under this CAS number, including other names
1-(TERT-BUTOXYCARBONYL)-1H-INDAZOLE-5-CARBOXYLIC ACID, 96% (CAS 885954-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471694-100MG |
| cas | 885954-14-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 1g | 1601.54 Pln | |
| Fluorochem | 5g | 5261.71 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid (CAS 885954-14-3) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid. InChIKey: LGQRJONGMRONKR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid |
| InChIKey | LGQRJONGMRONKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)C(=O)O)C=N1 |
Computed by PubChem (NCBI)