CAS 1214025-50-9 is the registry number for 3-(1-Benzyl-2,5-dioxoimidazolidin-4-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)propanoic acid (CAS 1214025-50-9) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)propanoic acid. InChIKey: ZHVHYSXUNVLQON-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(1-benzyl-2,5-dioxoimidazolidin-4-yl)propanoic acid |
| InChIKey | ZHVHYSXUNVLQON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)