Products 890625-72-6

CAS 890625-72-6 is the registry number for 3-(2,4-Dimethoxyphenyl)-4-methyl-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(2,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxylic acid (CAS 890625-72-6) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 3-(2,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxylic acid. InChIKey: DSWOTBXGABMHHH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O4
Molecular weight262.26 g/mol
IUPAC name3-(2,4-dimethoxyphenyl)-4-methyl-1H-pyrazole-5-carboxylic acid
InChIKeyDSWOTBXGABMHHH-UHFFFAOYSA-N
SMILESCC1=C(NN=C1C2=C(C=C(C=C2)OC)OC)C(=O)O

Computed by PubChem (NCBI)