CAS 885954-14-3 appears in our catalog under these names: 1-Boc-5-indazolecarboxylic acid, 95%, 1H-Indazole-1,5-dicarboxylic acid, 1-(1,1-dimethylethyl) ester, 96%, 96%, 1-(TERT-BUTOXYCARBONYL)-1H-INDAZOLE-5-CARBOXYLIC ACID, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid (CAS 885954-14-3) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid. InChIKey: LGQRJONGMRONKR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]indazole-5-carboxylic acid |
| InChIKey | LGQRJONGMRONKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)C(=O)O)C=N1 |
Computed by PubChem (NCBI)