cas: 1000576-23-7 — see every product listed under this CAS number, including other names
1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carboxylic acid 95% (CAS 1000576-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A708676-100mg |
| cas | 1000576-23-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 770.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A708676 |
1-(oxan-2-yl)indazole-4-carboxylic acid (CAS 1000576-23-7) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 1-(oxan-2-yl)indazole-4-carboxylic acid. InChIKey: SFBZBDJWQOVUGI-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 1-(oxan-2-yl)indazole-4-carboxylic acid |
| InChIKey | SFBZBDJWQOVUGI-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC=CC(=C3C=N2)C(=O)O |
Computed by PubChem (NCBI)