CAS 77471-41-1 appears in our catalog under these names: H–Ala–AMC, H-Ala-amc, 95%, (S)-2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)propanamide, 98%, H-L-Ala-AMC, L-Alanine-7-amido-4-methylcoumarin hydrochloride. Offered by: GLPBio, Combi-blocks, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 5g, 500mg, 100mg, 5mg, 1000mg.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 77471-41-1) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: IWSOXHMIRLSLKT-QMMMGPOBSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | IWSOXHMIRLSLKT-QMMMGPOBSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)N |
Computed by PubChem (NCBI)