Products 17952-63-5

CAS 17952-63-5 is the registry number for 6-Methoxy-1,2,3,4-tetrahydro-9h-pyrido[3,4-b]indole-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid (CAS 17952-63-5) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid. InChIKey: GHEBCEHFQAHKRP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O3
Molecular weight246.26 g/mol
IUPAC name6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid
InChIKeyGHEBCEHFQAHKRP-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)NC3=C2CCNC3C(=O)O

Computed by PubChem (NCBI)