Products 851628-34-7

CAS 851628-34-7 is the registry number for 4-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid (CAS 851628-34-7) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid. InChIKey: PPUHLVJYPWCTSG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14N2O3
Molecular weight246.26 g/mol
IUPAC name4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid
InChIKeyPPUHLVJYPWCTSG-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=NOC(=N2)CCCC(=O)O

Computed by PubChem (NCBI)