cas: 2377587-58-9 — see every product listed under this CAS number, including other names
1-(Tetrahydro-2H-pyran-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-5-carbaldehyde 95% (CAS 2377587-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1499248-100mg |
| cas | 2377587-58-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 2139.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1499248 |
1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde (CAS 2377587-58-9) is a chemical compound with the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. IUPAC name: 1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde. InChIKey: FBGODNQUPAADSI-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O4 |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | 1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-5-carbaldehyde |
| InChIKey | FBGODNQUPAADSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N(N=C2)C3CCCCO3)C=O |
Computed by PubChem (NCBI)