cas: 1260382-88-4 — see every product listed under this CAS number, including other names
1-(benzenesulfonyl)-6-chloro-pyrrolo[3,2-c]pyridine, 97%, 97% (CAS 1260382-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12RLMM-100mg |
| cas | 1260382-88-4 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 7490.00 Pln | |
| Chemat | 25g | 14915.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)-6-chloropyrrolo[3,2-c]pyridine (CAS 1260382-88-4) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-chloropyrrolo[3,2-c]pyridine. InChIKey: NCSQYCZGPQSPBM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-chloropyrrolo[3,2-c]pyridine |
| InChIKey | NCSQYCZGPQSPBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CN=C(C=C32)Cl |
Computed by PubChem (NCBI)