Products 1682655-04-4
CAS 1682655-04-4 appears in our catalog under these names: 1-(benzenesulfonyl)-7-chloro-1H-pyrrolo(3,2-b)pyridine, 97%, 1-(benzenesulfonyl)-7-chloro-1H-pyrrolo[3,2-b]pyridine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 500mg, 1g, 5g, 10g.
1-(benzenesulfonyl)-7-chloropyrrolo[3,2-b]pyridine (CAS 1682655-04-4) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-7-chloropyrrolo[3,2-b]pyridine. InChIKey: VETVCBWSBAPGJM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-7-chloropyrrolo[3,2-b]pyridine |
| InChIKey | VETVCBWSBAPGJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC=CC(=C32)Cl |
Computed by PubChem (NCBI)