CAS 896722-50-2 appears in our catalog under these names: 6–Chloro–1–(phenylsulfonyl)–1H–pyrrolo(2,3–b)pyridine, 6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%, 95%, 6-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(benzenesulfonyl)-6-chloropyrrolo[2,3-b]pyridine (CAS 896722-50-2) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-chloropyrrolo[2,3-b]pyridine. InChIKey: MLCIWUYAGVFRMD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-chloropyrrolo[2,3-b]pyridine |
| InChIKey | MLCIWUYAGVFRMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=C(C=C3)Cl |
Computed by PubChem (NCBI)