CAS 20299-79-0 appears in our catalog under these names: 1-(3-Methylphenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3-Methylphenyl)-1H-pyrrole-2,5-dione, 1-(m-Tolyl)-1H-pyrrole-2,5-dione, 97%, 97%, 1-(3-methylphenyl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 500mg, 1000mg, 2000mg, 5000mg, 10000mg, 100mg.
1-(3-methylphenyl)pyrrole-2,5-dione (CAS 20299-79-0) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-(3-methylphenyl)pyrrole-2,5-dione. InChIKey: PRZFFHNZHXGTRC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-(3-methylphenyl)pyrrole-2,5-dione |
| InChIKey | PRZFFHNZHXGTRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)