CAS 70170-23-9 appears in our catalog under these names: 5-Methyl-2-phenyl-1,3-oxazole-4-carbaldehyde, 95%, 5-Methyl-2-phenyloxazole-4-carbaldehyde, 97%, 5-Methyl-2-phenyl-1,3-oxazole-4-carbaldehyde, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-methyl-2-phenyl-1,3-oxazole-4-carbaldehyde (CAS 70170-23-9) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-methyl-2-phenyl-1,3-oxazole-4-carbaldehyde. InChIKey: JEXONSMPSXTJFF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-methyl-2-phenyl-1,3-oxazole-4-carbaldehyde |
| InChIKey | JEXONSMPSXTJFF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)