CAS 1956328-32-7 appears in our catalog under these names: 3-Methylquinoline-7-carboxylic acid, 95%, 3-Methylquinoline-7-carboxylic acid, 98%, 3-Methylquinoline-7-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-methylquinoline-7-carboxylic acid (CAS 1956328-32-7) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-methylquinoline-7-carboxylic acid. InChIKey: DWJJJYVYPBVXKG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-methylquinoline-7-carboxylic acid |
| InChIKey | DWJJJYVYPBVXKG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)