Products 55706-57-5
CAS 55706-57-5 appears in our catalog under these names: 6-Methylquinoline-8-carboxylic acid, 95%, 6-Methylquinoline-8-carboxylic acid, 6-Methylquinoline-8-carboxylic acid, 95%, 95%, 6-Methylquinoline-8-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 500mg, 5g.
6-methylquinoline-8-carboxylic acid (CAS 55706-57-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-methylquinoline-8-carboxylic acid. InChIKey: UUDPHSBAQDGNLA-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 6-methylquinoline-8-carboxylic acid |
| InChIKey | UUDPHSBAQDGNLA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)C(=O)O)N=CC=C2 |
Computed by PubChem (NCBI)