cas: 252990-05-9 — see every product listed under this CAS number, including other names
1-(tert-Butyl) 2-methyl (R)-piperazine-1,2-dicarboxylate 97% (CAS 252990-05-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132307-1g |
| cas | 252990-05-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 453.81 Pln | |
| Ambeed | 10g | 754.19 Pln | |
| Ambeed | 25g | 1783.25 Pln | |
| Ambeed | 100g | 5727.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132307 |
1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate (CAS 252990-05-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate. InChIKey: BRXKHIPPSTYCKO-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate |
| InChIKey | BRXKHIPPSTYCKO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)