cas: 1272756-00-9 — see every product listed under this CAS number, including other names
1-(tert-Butyl) 3-ethyl 5-hydroxypiperidine-1,3-dicarboxylate 98+% (CAS 1272756-00-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A605775-250mg |
| cas | 1272756-00-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Ambeed | 10g | 1861.13 Pln | |
| Ambeed | 25g | 3813.56 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A605775 |
1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate (CAS 1272756-00-9) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate. InChIKey: JZPKVZMVVCCMSR-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | JZPKVZMVVCCMSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)