cas: 1272756-00-9 — see every product listed under this CAS number, including other names
Ethyl N-Boc-5-hydroxypiperidine-3-carboxylate, 95%, 95% (CAS 1272756-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WU2-100mg |
| cas | 1272756-00-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 827.60 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3371.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate (CAS 1272756-00-9) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate. InChIKey: JZPKVZMVVCCMSR-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | JZPKVZMVVCCMSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)