cas: 1272756-00-9 — see every product listed under this CAS number, including other names
1-TERT-BUTYL 3-ETHYL 5-HYDROXYPIPERIDINE-1,3-DICARBOXYLATE, 95% (CAS 1272756-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305337-100MG |
| cas | 1272756-00-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1445.34 Pln | |
| Fluorochem | 10g | 2580.36 Pln | |
| Fluorochem | 25g | 5558.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate (CAS 1272756-00-9) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate. InChIKey: JZPKVZMVVCCMSR-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 5-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | JZPKVZMVVCCMSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)