cas: 1886-57-3 — see every product listed under this CAS number, including other names
1-(tert-Butyl)-2-nitrobenzene, 97% (CAS 1886-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F458733-1G |
| cas | 1886-57-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 690.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-tert-butyl-2-nitrobenzene (CAS 1886-57-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 1-tert-butyl-2-nitrobenzene. InChIKey: IWTHGPTVKBEURV-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 1-tert-butyl-2-nitrobenzene |
| InChIKey | IWTHGPTVKBEURV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)