Products 1187927-21-4

CAS 1187927-21-4 is the registry number for (S)-Methyl 3-(1-aminoethyl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-[(1S)-1-aminoethyl]benzoate (CAS 1187927-21-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-[(1S)-1-aminoethyl]benzoate. InChIKey: JDYAYNLXJBZWGS-ZETCQYMHSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC namemethyl 3-[(1S)-1-aminoethyl]benzoate
InChIKeyJDYAYNLXJBZWGS-ZETCQYMHSA-N
SMILESC[C@@H](C1=CC(=CC=C1)C(=O)OC)N

Computed by PubChem (NCBI)