CAS 1187927-21-4 is the registry number for (S)-Methyl 3-(1-aminoethyl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 3-[(1S)-1-aminoethyl]benzoate (CAS 1187927-21-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-[(1S)-1-aminoethyl]benzoate. InChIKey: JDYAYNLXJBZWGS-ZETCQYMHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-[(1S)-1-aminoethyl]benzoate |
| InChIKey | JDYAYNLXJBZWGS-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(=O)OC)N |
Computed by PubChem (NCBI)