cas: 121751-67-5 — see every product listed under this CAS number, including other names
1-[(4-Methoxyphenyl)sulfonyl]piperazine, HCl, ≥98%, ≥98% (CAS 121751-67-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126TD-250mg |
| cas | 121751-67-5 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 976.40 Pln | |
| Chemat | 5g | 3213.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-(4-methoxyphenyl)sulfonylpiperazine (CAS 121751-67-5) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: 1-(4-methoxyphenyl)sulfonylpiperazine. InChIKey: RYCVCXVHXZLECQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)sulfonylpiperazine |
| InChIKey | RYCVCXVHXZLECQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CCNCC2 |
Computed by PubChem (NCBI)