CAS 389605-69-0 appears in our catalog under these names: 4-Amino-n-(tetrahydrofuran-2-ylmethyl)benzenesulfonamide, 96%, 4-Amino-N-((tetrahydrofuran-2-yl)methyl)benzenesulfonamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g, 25g.
4-amino-N-(oxolan-2-ylmethyl)benzenesulfonamide (CAS 389605-69-0) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: 4-amino-N-(oxolan-2-ylmethyl)benzenesulfonamide. InChIKey: OJMPLCRVIRCWAV-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 4-amino-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| InChIKey | OJMPLCRVIRCWAV-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)