Products 217962-82-8

CAS 217962-82-8 is the registry number for 2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (CAS 217962-82-8) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate. InChIKey: VOFMVGKEJXTNCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O3S
Molecular weight256.32 g/mol
IUPAC nameethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate
InChIKeyVOFMVGKEJXTNCQ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=C1C)C(=O)N(C)C)N

Computed by PubChem (NCBI)