CAS 217962-82-8 is the registry number for 2-Amino-5-dimethylcarbamoyl-4-methyl-thiophene-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate (CAS 217962-82-8) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate. InChIKey: VOFMVGKEJXTNCQ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | ethyl 2-amino-5-(dimethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| InChIKey | VOFMVGKEJXTNCQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1C)C(=O)N(C)C)N |
Computed by PubChem (NCBI)