Products 2288709-01-1
CAS 2288709-01-1 is the registry number for tert-Butyl N-[2-(methylcarbamoyl)thiophen-3-yl]carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-[2-(methylcarbamoyl)thiophen-3-yl]carbamate (CAS 2288709-01-1) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: tert-butyl N-[2-(methylcarbamoyl)thiophen-3-yl]carbamate. InChIKey: HIBFGPIYFBIRNG-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | tert-butyl N-[2-(methylcarbamoyl)thiophen-3-yl]carbamate |
| InChIKey | HIBFGPIYFBIRNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(SC=C1)C(=O)NC |
Computed by PubChem (NCBI)