cas: 31271-90-6 — see every product listed under this CAS number, including other names
1-[(4-Methylphenyl)sulfonyl]-1H-indole, 95% (CAS 31271-90-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633234-250MG |
| cas | 31271-90-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1841.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-methylphenyl)sulfonylindole (CAS 31271-90-6) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylindole. InChIKey: JNRRPYFLDADLJW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylindole |
| InChIKey | JNRRPYFLDADLJW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)