cas: 31271-90-6 — see every product listed under this CAS number, including other names
1H-Indole, 1-[(4-methylphenyl)sulfonyl]-, 95+%, 95+% (CAS 31271-90-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SF8-250mg |
| cas | 31271-90-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 539.60 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1970.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-(4-methylphenyl)sulfonylindole (CAS 31271-90-6) is a chemical compound with the molecular formula C15H13NO2S and a molecular weight of 271.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylindole. InChIKey: JNRRPYFLDADLJW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2S |
|---|---|
| Molecular weight | 271.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylindole |
| InChIKey | JNRRPYFLDADLJW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)