1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclohexaneacetic acid, 95%, 95%
cas: 282524-98-5 — see every product listed under this CAS number, including other names
1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclohexaneacetic acid, 95%, 95% (CAS 282524-98-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBK1-5g |
| cas | 282524-98-5 |
| size | 5g |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1576.40 Pln | |
| Chemat | 10g | 2334.80 Pln | |
| Chemat | 25g | 4610.00 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 544.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid (CAS 282524-98-5) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid. InChIKey: XAUDVWHRZVURNT-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid |
| InChIKey | XAUDVWHRZVURNT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-1-amino-cyclohexane acetic acid, (1-Fmoc-aminocyclohexyl)acetic acid, N-Fmoc-2-(1-aminocyclohexyl)acetic acid, (1-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclohexyl)acetic acid, 2-[1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexyl]acetic acid, 1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclohexaneacetic acid, 2-(1-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)cyclohexyl)acetic acid, (Fmoc-NH-cyclohexyl)acetic acid, Fmoc-beta-3,3-Ac6c-OH, Fmoc-1-amino-cyclohexaneaceticacid