cas: 1418144-62-3 — see every product listed under this CAS number, including other names
1-[3-Bromo-4-(hydroxymethyl)phenyl]ethan-1-one, 98% (CAS 1418144-62-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602752-250MG |
| cas | 1418144-62-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 10g | 2923.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[3-bromo-4-(hydroxymethyl)phenyl]ethanone (CAS 1418144-62-3) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-[3-bromo-4-(hydroxymethyl)phenyl]ethanone. InChIKey: GADHCGDXVNYHTF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-[3-bromo-4-(hydroxymethyl)phenyl]ethanone |
| InChIKey | GADHCGDXVNYHTF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)CO)Br |
Computed by PubChem (NCBI)