cas: 1173036-46-8 — see every product listed under this CAS number, including other names
1-[4-(3-methoxyphenyl)-1h-imidazol-2-yl]ethan-1-amine dihydrochloride, 97% (CAS 1173036-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F663509-100MG |
| cas | 1173036-46-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2090.95 Pln | |
| Fluorochem | 10g | 3965.29 Pln | |
| Fluorochem | 25g | 6776.80 Pln | |
| Fluorochem | 50g | 10806.63 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1581.20 Pln | |
| Chemat | 10g | 2598.80 Pln | |
| Chemat | 25g | 5133.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride (CAS 1173036-46-8) is a chemical compound with the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. IUPAC name: 1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride. InChIKey: JZCAVEXNQIKMID-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3O |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | 1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride |
| InChIKey | JZCAVEXNQIKMID-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(N1)C2=CC(=CC=C2)OC)N.Cl.Cl |
Computed by PubChem (NCBI)