CAS 1235440-74-0 is the registry number for N-(3-Chlorophenyl)-1,4-diazepane-1-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-(3-chlorophenyl)-1,4-diazepane-1-carboxamide;hydrochloride (CAS 1235440-74-0) is a chemical compound with the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. IUPAC name: N-(3-chlorophenyl)-1,4-diazepane-1-carboxamide;hydrochloride. InChIKey: JABMDIHFYQJEEW-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3O |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | N-(3-chlorophenyl)-1,4-diazepane-1-carboxamide;hydrochloride |
| InChIKey | JABMDIHFYQJEEW-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)NC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)