Products 1458615-93-4
CAS 1458615-93-4 is the registry number for 4-((1-Ethyl-1H-pyrazol-4-yl)methoxy)aniline dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[(1-ethylpyrazol-4-yl)methoxy]aniline;dihydrochloride (CAS 1458615-93-4) is a chemical compound with the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. IUPAC name: 4-[(1-ethylpyrazol-4-yl)methoxy]aniline;dihydrochloride. InChIKey: SHTRSRVFICKXOS-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3O |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | 4-[(1-ethylpyrazol-4-yl)methoxy]aniline;dihydrochloride |
| InChIKey | SHTRSRVFICKXOS-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)COC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)