CAS 1173036-46-8 appears in our catalog under these names: 1-(4-(3-Methoxyphenyl)-1H-imidazol-2-yl)ethan-1-amine dihydrochloride, 97%, 1-[4-(3-methoxyphenyl)-1h-imidazol-2-yl]ethan-1-amine dihydrochloride, 97%, 97%, 1-[4-(3-methoxyphenyl)-1h-imidazol-2-yl]ethan-1-amine dihydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 100mg, 1g, 5g, 10g, 50g.
1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride (CAS 1173036-46-8) is a chemical compound with the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. IUPAC name: 1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride. InChIKey: JZCAVEXNQIKMID-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N3O |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | 1-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]ethanamine;dihydrochloride |
| InChIKey | JZCAVEXNQIKMID-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(N1)C2=CC(=CC=C2)OC)N.Cl.Cl |
Computed by PubChem (NCBI)