cas: 260441-69-8 — see every product listed under this CAS number, including other names
1-{[(E)-2-phenylvinyl]sulfonyl}piperidine-4-carboxylic acid, 98% (CAS 260441-69-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F315104-250MG |
| cas | 260441-69-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 2101.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylic acid (CAS 260441-69-8) is a chemical compound with the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. IUPAC name: 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylic acid. InChIKey: LAFAILDKFOBJFF-DHZHZOJOSA-N.
| Molecular formula | C14H17NO4S |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | 1-[(E)-2-phenylethenyl]sulfonylpiperidine-4-carboxylic acid |
| InChIKey | LAFAILDKFOBJFF-DHZHZOJOSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)