Products 1008029-46-6
CAS 1008029-46-6 is the registry number for 4-(Thiophene-2-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(thiophene-2-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid (CAS 1008029-46-6) is a chemical compound with the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. IUPAC name: 4-(thiophene-2-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: PTWRDEGOIZXKJB-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4S |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | 4-(thiophene-2-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | PTWRDEGOIZXKJB-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)N(C(CO2)C(=O)O)C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)