Products 1189930-99-1
CAS 1189930-99-1 is the registry number for N-(2-Benzoylmercaptopropionyl)glycine ethyl ester-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
Ethyl 2-[(2-benzoylsulfanyl-3,3,3-trideuteriopropanoyl)amino]acetate (CAS 1189930-99-1) is a chemical compound with the molecular formula C14H17NO4S and a molecular weight of 298.37 g/mol. IUPAC name: ethyl 2-[(2-benzoylsulfanyl-3,3,3-trideuteriopropanoyl)amino]acetate. InChIKey: ZBVZLHQTQDZZPB-BMSJAHLVSA-N.
| Molecular formula | C14H17NO4S |
|---|---|
| Molecular weight | 298.37 g/mol |
| IUPAC name | ethyl 2-[(2-benzoylsulfanyl-3,3,3-trideuteriopropanoyl)amino]acetate |
| InChIKey | ZBVZLHQTQDZZPB-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)NCC(=O)OCC)SC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)