CAS 340974-13-2 is the registry number for Methyl 4-(cyclohexylthio)-3-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-cyclohexylsulfanyl-3-nitrobenzoate (CAS 340974-13-2) is a chemical compound with the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. IUPAC name: methyl 4-cyclohexylsulfanyl-3-nitrobenzoate. InChIKey: KSZIJBUMOFZRNS-UHFFFAOYSA-N.
| Molecular formula | C14H17NO4S |
|---|---|
| Molecular weight | 295.36 g/mol |
| IUPAC name | methyl 4-cyclohexylsulfanyl-3-nitrobenzoate |
| InChIKey | KSZIJBUMOFZRNS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)SC2CCCCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)