cas: 400878-26-4 — see every product listed under this CAS number, including other names
1-{3-[(2-Chloro-6-fluorobenzyl)oxy]phenyl}-1-ethanone (CAS 400878-26-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010026-250MG |
| cas | 400878-26-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 924.69 Pln |
| delivery time | 2-3 weeks |
|---|
1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone (CAS 400878-26-4) is a chemical compound with the molecular formula C15H12ClFO2 and a molecular weight of 278.70 g/mol. IUPAC name: 1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone. InChIKey: ICXRLGDPQGRJAS-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFO2 |
|---|---|
| Molecular weight | 278.70 g/mol |
| IUPAC name | 1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone |
| InChIKey | ICXRLGDPQGRJAS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)