Products 1820741-86-3
CAS 1820741-86-3 is the registry number for methyl 2-chloro-4-(3-fluoro-4-methylphenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-chloro-4-(3-fluoro-4-methylphenyl)benzoate (CAS 1820741-86-3) is a chemical compound with the molecular formula C15H12ClFO2 and a molecular weight of 278.70 g/mol. IUPAC name: methyl 2-chloro-4-(3-fluoro-4-methylphenyl)benzoate. InChIKey: OASSAIWNMPUUPU-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFO2 |
|---|---|
| Molecular weight | 278.70 g/mol |
| IUPAC name | methyl 2-chloro-4-(3-fluoro-4-methylphenyl)benzoate |
| InChIKey | OASSAIWNMPUUPU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC(=C(C=C2)C(=O)OC)Cl)F |
Computed by PubChem (NCBI)