CAS 400878-26-4 appears in our catalog under these names: 1-(3-[(2-Chloro-6-fluorobenzyl)oxy]phenyl)-1-ethanone, 95%, 1-{3-[(2-Chloro-6-fluorobenzyl)oxy]phenyl}-1-ethanone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone (CAS 400878-26-4) is a chemical compound with the molecular formula C15H12ClFO2 and a molecular weight of 278.70 g/mol. IUPAC name: 1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone. InChIKey: ICXRLGDPQGRJAS-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFO2 |
|---|---|
| Molecular weight | 278.70 g/mol |
| IUPAC name | 1-[3-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethanone |
| InChIKey | ICXRLGDPQGRJAS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)OCC2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)