CAS 730992-77-5 is the registry number for 8-(Chloromethyl)-6-fluoro-2-phenyl-2,4-dihydro-1,3-benzodioxine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
8-(chloromethyl)-6-fluoro-2-phenyl-4H-1,3-benzodioxine (CAS 730992-77-5) is a chemical compound with the molecular formula C15H12ClFO2 and a molecular weight of 278.70 g/mol. IUPAC name: 8-(chloromethyl)-6-fluoro-2-phenyl-4H-1,3-benzodioxine. InChIKey: BBKOMRVUJRZUOI-UHFFFAOYSA-N.
| Molecular formula | C15H12ClFO2 |
|---|---|
| Molecular weight | 278.70 g/mol |
| IUPAC name | 8-(chloromethyl)-6-fluoro-2-phenyl-4H-1,3-benzodioxine |
| InChIKey | BBKOMRVUJRZUOI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)CCl)OC(O1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)