1-Allylindoline-2,3-dione, 95%, 95%
cas: 830-74-0 — see every product listed under this CAS number, including other names
1-Allylindoline-2,3-dione, 95%, 95% (CAS 830-74-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11633G-100mg |
| cas | 830-74-0 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1974.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-prop-2-enylindole-2,3-dione (CAS 830-74-0) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-prop-2-enylindole-2,3-dione. InChIKey: ZWNYDPBLEDGGQD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-prop-2-enylindole-2,3-dione |
| InChIKey | ZWNYDPBLEDGGQD-UHFFFAOYSA-N |
| SMILES | C=CCN1C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)
Synonyms:
1-allylisatin, 1-allyl-1H-indole-2,3-dione, 1-allylindoline-2,3-dione, 1-prop-2-enylindole-2,3-dione, 1-(prop-2-en-1-yl)-2,3-dihydro-1H-indole-2,3-dione, n-allylisatin, 1-Allyl-2,3-indolinedione, 1H-Indole-2,3-dione, 1-(2-propenyl)-, 1-(prop-2-en-1-yl)-1H-indole-2,3-dione, 1-Allylindole-2,3-dione